![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The way of getting an invitation for studying.docx | 2017-07-18 14:25 | 11K | |
| Согласие на обработку персональнных данных.docx | 2017-07-28 13:06 | 13K | |
| Yabancılar ve vatansız insanlar okumaya kabul kuralları .docx | 2017-07-24 12:54 | 20K | |
| Rules of admission to studying foreigners and stateless persons .docx | 2017-07-18 14:25 | 20K | |
| image001.jpg | 2017-07-18 14:23 | 22K | |
| Consent to the processing of personal data.doc | 2017-07-18 14:25 | 26K | |
| Kişisel verilerin işlenmesine onay verme .doc | 2017-07-24 12:54 | 26K | |
| Okula davet .doc | 2017-07-24 12:54 | 26K | |
| Правила приёма иностранцев и лиц без гражданства.docx | 2017-09-05 06:05 | 26K | |
| Порядок выдачи приглашений.doc | 2017-09-05 06:05 | 27K | |
| Сроки и стоимость обучения__del.doc | 2017-09-05 06:05 | 38K | |
| Terms and cost of studying for foreign citizenz.doc | 2017-07-18 14:25 | 39K | |
| Yabancı vatandaşlar için çalışma koşulları ve ücreti .doc | 2017-07-24 12:54 | 40K | |